CymitQuimica logo

CAS 914348-64-4

:

methyl 1-(4-chloro-5-formyl-thiazol-2-yl)piperidine-4-carboxylate

Description:
Methyl 1-(4-chloro-5-formyl-thiazol-2-yl)piperidine-4-carboxylate is a chemical compound characterized by its complex structure, which includes a piperidine ring, a thiazole moiety, and a formyl group. The presence of the chloro substituent on the thiazole ring contributes to its reactivity and potential biological activity. This compound is typically classified as an intermediate in organic synthesis and may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals. Its carboxylate ester functionality suggests it could participate in various chemical reactions, such as hydrolysis or transesterification. The thiazole and piperidine components may impart specific pharmacological properties, making it of interest in drug discovery. Additionally, the compound's solubility, stability, and reactivity can be influenced by its molecular structure, which is essential for applications in both research and industry. Safety and handling precautions should be observed due to the presence of chlorine and other reactive groups.
Formula:C11H13ClN2O3S
InChI:InChI=1/C11H13ClN2O3S/c1-17-10(16)7-2-4-14(5-3-7)11-13-9(12)8(6-15)18-11/h6-7H,2-5H2,1H3
SMILES:COC(=O)C1CCN(CC1)c1nc(c(C=O)s1)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.