CAS 914348-84-8
:2-(3-fluorophenyl)thiazole-5-carbaldehyde
Description:
2-(3-Fluorophenyl)thiazole-5-carbaldehyde is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of a fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring at the meta position, which can influence the compound's electronic properties and reactivity. The aldehyde functional group (-CHO) at the 5-position of the thiazole ring contributes to its reactivity, making it a potential candidate for various chemical reactions, including condensation and nucleophilic addition. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure allows for potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. Additionally, the presence of the fluorine atom can enhance lipophilicity and metabolic stability, which are important factors in pharmacology. Overall, 2-(3-fluorophenyl)thiazole-5-carbaldehyde is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C10H6FNOS
InChI:InChI=1/C10H6FNOS/c11-8-3-1-2-7(4-8)10-12-5-9(6-13)14-10/h1-6H
SMILES:c1cc(cc(c1)F)c1ncc(C=O)s1
Synonyms:- 2-(3-Fluorophenyl)-1,3-thiazole-5-carbaldehyde
- 5-Thiazolecarboxaldehyde, 2-(3-Fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
