CymitQuimica logo

CAS 914348-85-9

:

2-(3,4-dimethoxyphenyl)thiazole-5-carbaldehyde

Description:
2-(3,4-Dimethoxyphenyl)thiazole-5-carbaldehyde is an organic compound characterized by its thiazole and aldehyde functional groups. The thiazole ring contributes to its heterocyclic nature, while the aldehyde group is indicative of its reactivity, particularly in condensation reactions. The presence of two methoxy groups on the phenyl ring enhances its electron-donating properties, which can influence its reactivity and solubility in organic solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. Additionally, the compound's unique combination of functional groups may impart specific optical or electronic properties, which could be explored in materials science. Overall, 2-(3,4-dimethoxyphenyl)thiazole-5-carbaldehyde is a versatile compound with potential applications across various fields of chemistry.
Formula:C12H11NO3S
InChI:InChI=1/C12H11NO3S/c1-15-10-4-3-8(5-11(10)16-2)12-13-6-9(7-14)17-12/h3-7H,1-2H3
SMILES:COc1ccc(cc1OC)c1ncc(C=O)s1
Synonyms:
  • 2-(3,4-Dimethoxyphenyl)-1,3-thiazole-5-carbaldehyde
  • 5-Thiazolecarboxaldehyde, 2-(3,4-Dimethoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.