CAS 914348-87-1

4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(trifluoromethyl)aniline

Description:

4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(trifluoromethyl)aniline, identified by its CAS number 914348-87-1, is a chemical compound characterized by its complex structure, which includes an isoquinoline moiety and a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of the isoquinoline ring and the aniline functional group. The trifluoromethyl group contributes to its lipophilicity and can influence its reactivity and biological activity. The presence of nitrogen in the isoquinoline structure may also impart basicity, allowing for potential interactions in biological systems. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that could interact with biological targets. Additionally, its stability and solubility characteristics would depend on the specific conditions of use, such as solvent and pH. Overall, this compound represents a class of organic molecules with potential applications in various fields, including drug discovery and material science.

Formula: C₁₆H₁₅F₃N₂

InChI: InChI=1/C16H15F3N2/c17-16(18,19)14-9-13(20)5-6-15(14)21-8-7-11-3-1-2-4-12(11)10-21/h1-6,9H,7-8,10,20H2

SMILES: c1ccc2CN(CCc2c1)c1ccc(cc1C(F)(F)F)N

4-(3,4-Dihydro-1h-isoquinolin-2-yl)-3-trifluoromethylphenylamine

CAS: 914348-87-1

Formula: C₁₆H₁₅F₃N₂

Molecular weight: 292.2989

Ref: IN-DA00GRHZ