CAS 914348-89-3
:2-[4-nitro-2-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinoline
Description:
2-[4-Nitro-2-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinoline is a chemical compound characterized by its complex structure, which includes an isoquinoline core fused with a phenyl group that carries both a nitro and a trifluoromethyl substituent. The presence of the nitro group typically imparts significant electron-withdrawing properties, influencing the compound's reactivity and potential applications in organic synthesis or medicinal chemistry. The trifluoromethyl group is known for enhancing lipophilicity and metabolic stability, which can be advantageous in drug design. This compound may exhibit interesting biological activities due to its unique structural features, making it a candidate for further research in pharmacology. Additionally, its molecular structure suggests potential interactions with various biological targets, which could be explored in the context of therapeutic development. Overall, the combination of functional groups and the isoquinoline framework contribute to its chemical properties and potential utility in various scientific fields.
Formula:C16H13F3N2O2
InChI:InChI=1/C16H13F3N2O2/c17-16(18,19)14-9-13(21(22)23)5-6-15(14)20-8-7-11-3-1-2-4-12(11)10-20/h1-6,9H,7-8,10H2
SMILES:c1ccc2CN(CCc2c1)c1ccc(cc1C(F)(F)F)N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-[4-Nitro-2-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydroisoquinoline
CAS:Formula:C16H13F3N2O2Molecular weight:322.2818
