CAS 914348-90-6
:2-(6-methoxy-2-naphthyl)piperazine
Description:
2-(6-Methoxy-2-naphthyl)piperazine is a chemical compound characterized by its unique structure, which includes a piperazine ring and a naphthalene moiety substituted with a methoxy group. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many naphthalene derivatives. The presence of the methoxy group can influence its electronic properties, potentially enhancing its lipophilicity and affecting its biological activity. As a piperazine derivative, it may interact with various biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's molecular structure suggests potential applications in areas such as neuropharmacology or as a scaffold for drug design. Additionally, its CAS number, 914348-90-6, allows for easy identification and reference in chemical databases. Overall, 2-(6-methoxy-2-naphthyl)piperazine represents a compound with intriguing characteristics that warrant further investigation for its potential therapeutic uses.
Formula:C15H18N2O
InChI:InChI=1/C15H18N2O/c1-18-14-5-4-11-8-13(3-2-12(11)9-14)15-10-16-6-7-17-15/h2-5,8-9,15-17H,6-7,10H2,1H3
SMILES:COc1ccc2cc(ccc2c1)C1CNCCN1
Synonyms:- Piperazine, 2-(6-Methoxy-2-Naphthalenyl)-
- 2-(6-Methoxy-2-naphthyl)piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
