CAS 914348-91-7
:2-(2,5-dichlorophenyl)piperazine
Description:
2-(2,5-Dichlorophenyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a dichlorophenyl group, specifically with chlorine substituents at the 2 and 5 positions of the phenyl ring, contributing to its unique chemical properties. It is typically classified as an organic compound and may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, depending on the specific conditions. The presence of the piperazine moiety suggests potential biological activity, as piperazine derivatives are often explored in medicinal chemistry for their pharmacological properties, including effects on the central nervous system. Additionally, the dichlorophenyl group may influence the compound's reactivity and interaction with biological targets. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or environmental impact. Overall, 2-(2,5-dichlorophenyl)piperazine is of interest in both research and potential applications in pharmaceuticals.
Formula:C10H12Cl2N2
InChI:InChI=1/C10H12Cl2N2/c11-7-1-2-9(12)8(5-7)10-6-13-3-4-14-10/h1-2,5,10,13-14H,3-4,6H2
SMILES:c1cc(c(cc1Cl)C1CNCCN1)Cl
Synonyms:- Piperazine, 2-(2,5-Dichlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
