CAS 914349-02-3
:5-Chloro-N-hydroxy-1H-indole-3-carboximidamide
Description:
5-Chloro-N-hydroxy-1H-indole-3-carboximidamide is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a chloro group at the 5-position and a hydroxy group at the N-position contributes to its unique reactivity and potential biological activity. The carboximidamide functional group enhances its ability to form hydrogen bonds, which may influence its interactions with biological targets. This compound may exhibit properties such as solubility in polar solvents, and its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods. As with many indole derivatives, it may possess interesting pharmacological properties, making it a subject of interest in drug discovery and development. However, detailed studies would be necessary to fully elucidate its biological activity and potential applications.
Formula:C9H8ClN3O
InChI:InChI=1S/C9H8ClN3O/c10-5-1-2-8-6(3-5)7(4-12-8)9(11)13-14/h1-4,12,14H,(H2,11,13)
InChI key:InChIKey=NQUMMDGIACLAOM-UHFFFAOYSA-N
SMILES:C(NO)(=N)C=1C=2C(NC1)=CC=C(Cl)C2
Synonyms:- 1H-indole-3-carboximidamide, 5-chloro-N'-hydroxy-
- 5-chloro-N-hydroxy-1H-indole-3-carboximidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
