CymitQuimica logo

CAS 914349-17-0

:

methyl 6-methyl-4-(4-methylbenzoyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate

Description:
Methyl 6-methyl-4-(4-methylbenzoyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate, with the CAS number 914349-17-0, is a synthetic organic compound belonging to the pyrimidine class. This compound features a pyrimidine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms at positions 1 and 3. Its molecular structure includes a methyl group and a benzoyl moiety, contributing to its potential biological activity. The presence of the carboxylate group suggests it may exhibit acidic properties, while the ester functionality indicates it can undergo hydrolysis. This compound may be of interest in medicinal chemistry due to its structural features, which could influence its pharmacological properties. Additionally, its synthesis and characterization would typically involve standard organic reactions, and it may be evaluated for various applications, including as a potential drug candidate or in agrochemical formulations. As with many organic compounds, its stability, solubility, and reactivity would depend on environmental conditions and the presence of other chemical species.
Formula:C15H16N2O4
InChI:InChI=1/C15H16N2O4/c1-8-4-6-10(7-5-8)13(18)12-11(14(19)21-3)9(2)16-15(20)17-12/h4-7,12H,1-3H3,(H2,16,17,20)
SMILES:Cc1ccc(cc1)C(=O)C1C(=C(C)N=C(N1)O)C(=O)OC
Synonyms:
  • Methyl 6-methyl-4-(4-methylbenzoyl)-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.