CAS 914349-19-2
:4-(6-chloropyridazin-3-yl)benzaldehyde
Description:
4-(6-Chloropyridazin-3-yl)benzaldehyde is an organic compound characterized by its structure, which features a benzaldehyde moiety substituted with a 6-chloropyridazin-3-yl group. This compound typically exhibits properties common to aldehydes, such as being a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic aromatic components. The presence of the chloropyridazine ring introduces unique reactivity, potentially allowing for various chemical transformations, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in the development of agrochemicals or as intermediates in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H7ClN2O
InChI:InChI=1/C11H7ClN2O/c12-11-6-5-10(13-14-11)9-3-1-8(7-15)2-4-9/h1-7H
SMILES:c1cc(ccc1C=O)c1ccc(Cl)nn1
Synonyms:- 4-(6-Chloro-3-pyridazinyl)benzaldehyde
- Benzaldehyde, 4-(6-chloro-3-pyridazinyl)-
- T6Nnj Cg Fr Dvh
- 4-(6-Chloropyridazin-3-yl)benzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
