CAS 914349-20-5
:1-[4-(Hydroxymethyl)phenyl]-4-piperidinol
Description:
1-[4-(Hydroxymethyl)phenyl]-4-piperidinol, identified by its CAS number 914349-20-5, is an organic compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a hydroxymethyl group attached to a phenyl ring, contributing to its potential solubility in polar solvents. The presence of both the hydroxymethyl and piperidinol functionalities suggests that it may exhibit hydrogen bonding capabilities, influencing its reactivity and interactions with other molecules. It may also possess biological activity, making it of interest in medicinal chemistry and pharmacology. The compound's structural features could allow it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, its properties may be further influenced by factors such as pH and temperature, which can affect its stability and solubility. Overall, 1-[4-(Hydroxymethyl)phenyl]-4-piperidinol represents a versatile compound with potential applications in research and development within the chemical and pharmaceutical industries.
Formula:C12H17NO2
InChI:InChI=1S/C12H17NO2/c14-9-10-1-3-11(4-2-10)13-7-5-12(15)6-8-13/h1-4,12,14-15H,5-9H2
InChI key:InChIKey=HHSLCCVWYRRLNH-UHFFFAOYSA-N
SMILES:C(O)C1=CC=C(C=C1)N2CCC(O)CC2
Synonyms:- 1-[4-(Hydroxymethyl)phenyl]-4-piperidinol
- 4-Piperidinol, 1-[4-(Hydroxymethyl)Phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
