CAS 914349-21-6

[1-(2-pyridylmethyl)-4-piperidyl]methanol

Description:

[1-(2-pyridylmethyl)-4-piperidyl]methanol, identified by its CAS number 914349-21-6, is a chemical compound characterized by its unique structural features, which include a piperidine ring and a pyridine moiety. This compound typically exhibits properties associated with both amines and alcohols due to the presence of the piperidine nitrogen and the hydroxymethyl group. It is likely to be a white to off-white solid at room temperature, with moderate solubility in polar solvents such as water and alcohols, owing to its hydroxyl group. The presence of the pyridine ring may impart some degree of basicity and potential for coordination with metal ions. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its specific interactions and reactivity can vary based on the functional groups present, influencing its potential applications in drug development or as a chemical intermediate. As with any chemical substance, proper handling and safety measures should be observed due to potential toxicity or reactivity.

Formula: C₁₂H₁₈N₂O

InChI: InChI=1/C12H18N2O/c15-10-11-4-7-14(8-5-11)9-12-3-1-2-6-13-12/h1-3,6,11,15H,4-5,7-10H2

SMILES: c1ccnc(c1)CN1CCC(CC1)CO

Synonyms:

• [1-(Pyridin-2-ylmethyl)piperidin-4-yl]methanol
• 4-Piperidinemethanol, 1-(2-Pyridinylmethyl)-

(1-Pyridin-2-ylmethylpiperidin-4-yl)methanol

CAS: 914349-21-6

Formula: C₁₂H₁₈N₂O

Molecular weight: 206.2841

Ref: IN-DA00GV1I