CAS 914349-46-5

3-(6-Chloro-3-pyridazinyl)benzoic acid

Description:

3-(6-Chloro-3-pyridazinyl)benzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety and a pyridazine ring substituted with a chlorine atom. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The chlorine substituent can influence the compound's electronic properties, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. Additionally, the carboxylic acid group (-COOH) contributes to its acidity and solubility in polar solvents. This compound may be of interest in medicinal chemistry and material science due to its potential biological activity and utility in synthesizing other complex molecules. Its specific applications would depend on further studies exploring its interactions and effects in various chemical environments. As with many chemical substances, safety data sheets should be consulted for handling and storage guidelines.

Formula: C₁₁H₇ClN₂O₂

InChI: InChI=1/C11H7ClN2O2/c12-10-5-4-9(13-14-10)7-2-1-3-8(6-7)11(15)16/h1-6H,(H,15,16)

InChI key: InChIKey=UNZBOMFXUMHBFC-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=CC1)C2=CC=C(Cl)N=N2

Synonyms:

• 3-(6-Chloro-3-pyridazinyl)benzoic acid
• Benzoic Acid, 3-(6-Chloro-3-Pyridazinyl)-
• 3-(6-Chloropyridazin-3-yl)benzoic acid

3-(6-Chloro-3-pyridazinyl)benzoic acid

CAS: 914349-46-5

Formula: C₁₁H₇ClN₂O₂

Color and Shape: Solid

Molecular weight: 234.6385

Ref: IN-DA003I5S

3-(6-Chloropyridazin-3-yl)benzoic acid

CAS: 914349-46-5

Formula: C₁₁H₇ClN₂O₂

Purity: 95.0%

Molecular weight: 234.64

Ref: 10-F077727