CymitQuimica logo

CAS 914349-50-1

:

Ethyl 1-[4-(hydroxymethyl)phenyl]-4-piperidinecarboxylate

Description:
Ethyl 1-[4-(hydroxymethyl)phenyl]-4-piperidinecarboxylate, identified by its CAS number 914349-50-1, is a chemical compound characterized by its unique structure that includes an ethyl ester group, a piperidine ring, and a phenyl group with a hydroxymethyl substituent. This compound typically exhibits properties associated with both esters and amines, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The hydroxymethyl group can participate in hydrogen bonding, influencing its solubility and interaction with biological systems. Ethyl 1-[4-(hydroxymethyl)phenyl]-4-piperidinecarboxylate may be of interest in medicinal chemistry for its potential pharmacological activities, particularly in the development of therapeutic agents. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity could be influenced by environmental factors such as pH and temperature. Overall, this compound represents a class of molecules that could have applications in drug development and other chemical research areas.
Formula:C15H21NO3
InChI:InChI=1/C15H21NO3/c1-2-19-15(18)13-7-9-16(10-8-13)14-5-3-12(11-17)4-6-14/h3-6,13,17H,2,7-11H2,1H3
InChI key:InChIKey=NINDVACLWGXYSY-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1CCN(CC1)C2=CC=C(CO)C=C2
Synonyms:
  • Ethyl 1-[4-(hydroxymethyl)phenyl]piperidine-4-carboxylate
  • 4-Piperidinecarboxylic acid, 1-[4-(hydroxymethyl)phenyl]-, ethyl ester
  • Ethyl 1-[4-(hydroxymethyl)phenyl]-4-piperidinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.