CAS 914349-51-2

2-(6-bromo-2-pyridyl)benzaldehyde

Description:

2-(6-Bromo-2-pyridyl)benzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group and a pyridine ring substituted with a bromine atom. The presence of the bromine atom at the 6-position of the pyridine ring enhances the compound's reactivity and can influence its electronic properties, making it useful in various chemical reactions, including electrophilic substitutions. This compound typically exhibits a yellow to brown color and is soluble in organic solvents such as ethanol and dichloromethane. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as well as in materials science for the synthesis of novel organic materials. Additionally, the compound may serve as a building block in organic synthesis, facilitating the creation of more complex molecules. Safety precautions should be taken when handling this substance, as it may pose health risks due to the presence of bromine and its potential reactivity.

Formula: C₁₂H₈BrNO

InChI: InChI=1/C12H8BrNO/c13-12-7-3-6-11(14-12)10-5-2-1-4-9(10)8-15/h1-8H

SMILES: c1ccc(c(c1)C=O)c1cccc(Br)n1

Synonyms:

• 2-(6-Bromopyridin-2-yl)benzaldehyde
• Benzaldehyde, 2-(6-Bromo-2-Pyridinyl)-

2-(6-Bromopyridin-2-yl)benzaldehyde

CAS: 914349-51-2

Formula: C₁₂H₈BrNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 262.1020

Ref: IN-DA00GRHX

2-(6-Bromopyridin-2-yl)benzaldehyde

CAS: 914349-51-2

2-(6-Bromopyridin-2-yl)benzaldehyde

Purity: 97%

Molecular weight: 262.10g/mol

Ref: 54-OR90648

2-(6-Bromopyridin-2-yl)benzaldehyde

CAS: 914349-51-2

Formula: C₁₂H₈BrNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 262.106

Ref: 10-F075809