CAS 914349-54-5
:2-[(4-ethylpiperazin-1-yl)methyl]benzoic acid
Description:
2-[(4-Ethylpiperazin-1-yl)methyl]benzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety and a piperazine ring substituted with an ethyl group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the carboxylic acid functional group. The piperazine ring contributes to its basicity, allowing it to form salts with acids. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the piperazine's known role in enhancing bioactivity and pharmacokinetic properties. The compound may also exhibit specific interactions with biological targets, making it of interest for further research in drug design and development. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure.
Formula:C14H20N2O2
InChI:InChI=1/C14H20N2O2/c1-2-15-7-9-16(10-8-15)11-12-5-3-4-6-13(12)14(17)18/h3-6H,2,7-11H2,1H3,(H,17,18)
SMILES:CCN1CCN(CC1)Cc1ccccc1C(=O)O
Synonyms:- Benzoic Acid, 2-[(4-Ethyl-1-Piperazinyl)Methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
