CAS 914349-58-9
:4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]benzaldehyde
Description:
4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]benzaldehyde is a chemical compound characterized by its complex structure, which includes a piperazine ring and a benzaldehyde functional group. The presence of two 4-fluorophenyl groups attached to the piperazine enhances its lipophilicity and may influence its biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the aldehyde functional group, which can participate in various chemical reactions, including condensation and reduction. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders or other therapeutic areas. The compound's specific interactions with biological targets would depend on its conformation and the presence of functional groups, making it a subject of interest for further research in drug design and synthesis. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.
Formula:C24H22F2N2O
InChI:InChI=1/C24H22F2N2O/c25-21-7-3-19(4-8-21)24(20-5-9-22(26)10-6-20)28-15-13-27(14-16-28)23-11-1-18(17-29)2-12-23/h1-12,17,24H,13-16H2
SMILES:c1cc(ccc1C=O)N1CCN(CC1)C(c1ccc(cc1)F)c1ccc(cc1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(4-[Bis(4-fluorophenyl)methyl]piperazin-1-yl)benzaldehyde
CAS:Formula:C24H22F2N2OMolecular weight:392.4411
