CAS 914349-58-9

4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]benzaldehyde

Description:

4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]benzaldehyde is a chemical compound characterized by its complex structure, which includes a piperazine ring and a benzaldehyde functional group. The presence of two 4-fluorophenyl groups attached to the piperazine enhances its lipophilicity and may influence its biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the aldehyde functional group, which can participate in various chemical reactions, including condensation and reduction. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders or other therapeutic areas. The compound's specific interactions with biological targets would depend on its conformation and the presence of functional groups, making it a subject of interest for further research in drug design and synthesis. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.

Formula: C₂₄H₂₂F₂N₂O

InChI: InChI=1/C24H22F2N2O/c25-21-7-3-19(4-8-21)24(20-5-9-22(26)10-6-20)28-15-13-27(14-16-28)23-11-1-18(17-29)2-12-23/h1-12,17,24H,13-16H2

SMILES: c1cc(ccc1C=O)N1CCN(CC1)C(c1ccc(cc1)F)c1ccc(cc1)F

4-(4-[Bis(4-fluorophenyl)methyl]piperazin-1-yl)benzaldehyde

CAS: 914349-58-9

Formula: C₂₄H₂₂F₂N₂O

Molecular weight: 392.4411

Ref: IN-DA00H027