CAS 914349-62-5
:[4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]phenyl]methanol
Description:
The chemical substance known as [4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]phenyl]methanol, with the CAS number 914349-62-5, is a complex organic compound characterized by its multi-functional structure. It features a piperazine ring, which is a common motif in pharmacologically active compounds, suggesting potential biological activity. The presence of fluorinated phenyl groups indicates enhanced lipophilicity and may influence the compound's interaction with biological targets. The hydroxyl group (-OH) in the methanol part of the structure can participate in hydrogen bonding, which may affect solubility and reactivity. This compound is likely to be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential to interact with various biological pathways. Its specific properties, such as solubility, stability, and biological activity, would depend on the overall molecular conformation and the electronic effects of the substituents present. Further studies would be necessary to elucidate its full chemical behavior and potential applications.
Formula:C24H24F2N2O
InChI:InChI=1/C24H24F2N2O/c25-21-7-3-19(4-8-21)24(20-5-9-22(26)10-6-20)28-15-13-27(14-16-28)23-11-1-18(17-29)2-12-23/h1-12,24,29H,13-17H2
SMILES:c1cc(ccc1CO)N1CCN(CC1)C(c1ccc(cc1)F)c1ccc(cc1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(4-(4-[Bis(4-fluorophenyl)methyl]piperazin-1-yl)phenyl)methanol
CAS:Formula:C24H24F2N2OMolecular weight:394.4570
