CymitQuimica logo

CAS 914349-63-6

:

4-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]methyl]aniline

Description:
4-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]methyl]aniline, with the CAS number 914349-63-6, is a chemical compound characterized by its complex structure, which includes a piperazine ring and multiple aromatic components. This substance typically exhibits properties associated with organic compounds, such as moderate solubility in organic solvents and potential interactions with biological systems due to its amine and aromatic functionalities. The presence of fluorine atoms in the structure may enhance its lipophilicity and influence its pharmacokinetic properties. As a piperazine derivative, it may exhibit biological activity, potentially acting as a ligand for various receptors or enzymes. The compound's synthesis involves multi-step organic reactions, and it may be of interest in medicinal chemistry for its potential therapeutic applications. Safety and handling considerations are essential, as with many organic compounds, particularly those containing fluorinated groups, which may pose specific environmental and health risks.
Formula:C24H25F2N3
InChI:InChI=1/C24H25F2N3/c25-21-7-3-19(4-8-21)24(20-5-9-22(26)10-6-20)29-15-13-28(14-16-29)17-18-1-11-23(27)12-2-18/h1-12,24H,13-17,27H2
SMILES:c1cc(ccc1CN1CCN(CC1)C(c1ccc(cc1)F)c1ccc(cc1)F)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.