CAS 914349-65-8

4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]aniline

Description:

4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]aniline, with the CAS number 914349-65-8, is a chemical compound characterized by its complex structure, which includes a piperazine ring and an aniline moiety. This compound features two 4-fluorophenyl groups attached to a central piperazine, contributing to its potential biological activity. The presence of fluorine atoms can enhance lipophilicity and influence the compound's interaction with biological targets. Typically, such compounds are investigated for their pharmacological properties, including potential applications in treating various conditions due to their ability to interact with neurotransmitter systems. The molecular structure suggests that it may exhibit properties such as moderate to high solubility in organic solvents, while its stability can be influenced by the presence of functional groups. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry, to confirm its identity and purity. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and drug development.

Formula: C₂₃H₂₃F₂N₃

InChI: InChI=1/C23H23F2N3/c24-19-5-1-17(2-6-19)23(18-3-7-20(25)8-4-18)28-15-13-27(14-16-28)22-11-9-21(26)10-12-22/h1-12,23H,13-16,26H2

SMILES: c1cc(ccc1C(c1ccc(cc1)F)N1CCN(CC1)c1ccc(cc1)N)F

4-(4-[Bis(4-fluorophenyl)methyl]piperazin-1-yl)phenylamine

CAS: 914349-65-8

Formula: C₂₃H₂₃F₂N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 379.4456

Ref: IN-DA00GV2U

4-(4-[Bis(4-fluorophenyl)methyl]piperazin-1-yl)phenylamine

CAS: 914349-65-8

4-(4-[Bis(4-fluorophenyl)methyl]piperazin-1-yl)phenylamine

Purity: 98%

Molecular weight: 379.45g/mol

Ref: 54-PC1002116

4-{4-[Bis(4-fluorophenyl)methyl]piperazin-1-yl}phenylamine

CAS: 914349-65-8

Purity: 98%

Molecular weight: 379.4549865722656

Ref: 10-F077780