CymitQuimica logo

CAS 914349-67-0

:

1-{4-[(4-ethylpiperazin-1-yl)methyl]phenyl}methanamine

Description:
1-{4-[(4-ethylpiperazin-1-yl)methyl]phenyl}methanamine, identified by its CAS number 914349-67-0, is a chemical compound characterized by its complex structure, which includes a phenyl group, a piperazine moiety, and an amine functional group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the piperazine ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The ethyl substitution on the piperazine enhances its lipophilicity, potentially affecting its pharmacokinetic properties. Additionally, the compound may exhibit interactions with biological targets, which could be relevant in drug design and development. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be studied for its potential applications in pharmaceuticals or as a research tool in biochemical studies. Overall, this compound represents a class of substances that could have significant implications in therapeutic contexts.
Formula:C14H23N3
InChI:InChI=1/C14H23N3/c1-2-16-7-9-17(10-8-16)12-14-5-3-13(11-15)4-6-14/h3-6H,2,7-12,15H2,1H3
InChI key:SAUDSDDZIRPWMO-UHFFFAOYSA-N
SMILES:CCN1CCN(CC1)Cc1ccc(cc1)CN
Synonyms:
  • Benzenemethanamine, 4-[(4-Ethyl-1-Piperazinyl)Methyl]-
Found 4 products.