CymitQuimica logo

CAS 914349-73-8

:

methyl 2-(2-amino-5-bromo-thiazol-4-yl)-2-oxo-acetate

Description:
Methyl 2-(2-amino-5-bromo-thiazol-4-yl)-2-oxo-acetate, with the CAS number 914349-73-8, is a chemical compound characterized by its thiazole ring structure, which incorporates a bromine atom and an amino group. This compound features an ester functional group, indicated by the presence of the methyl ester moiety, and a keto group, contributing to its reactivity and potential biological activity. The thiazole ring is known for its role in various pharmacological applications, often exhibiting antimicrobial and anti-inflammatory properties. The presence of the amino group enhances its potential for further chemical modifications, making it a versatile intermediate in organic synthesis. Additionally, the compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, influencing its solubility and stability in different solvents. Overall, this compound represents a significant interest in medicinal chemistry and drug development due to its unique structural features and potential therapeutic applications.
Formula:C6H5BrN2O3S
InChI:InChI=1/C6H5BrN2O3S/c1-12-5(11)3(10)2-4(7)13-6(8)9-2/h1H3,(H2,8,9)
SMILES:COC(=O)C(=O)c1c(Br)sc(=N)[nH]1
Synonyms:
  • 4-Thiazoleacetic Acid, 2-Amino-5-Bromo-Α-Oxo-, Methyl Ester
  • Methyl (2-amino-5-bromo-1,3-thiazol-4-yl)(oxo)acetate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.