CAS 914358-72-8

5-bromo-3-chloro-2-methyl-pyridine

Description:

5-Bromo-3-chloro-2-methyl-pyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with bromine, chlorine, and a methyl group. The presence of these halogen substituents can significantly influence its chemical reactivity and physical properties. Typically, compounds like this exhibit moderate polarity due to the electronegative halogens, which can affect solubility in various solvents. The bromine and chlorine atoms can also participate in nucleophilic substitution reactions, making the compound useful in synthetic organic chemistry. Additionally, the methyl group can provide steric hindrance, influencing the compound's reactivity and interaction with other molecules. This compound may be utilized in the synthesis of pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Its specific applications often depend on the functional groups present and the overall molecular structure. Safety data should be consulted, as halogenated compounds can pose health risks and environmental concerns.

Formula: C₆H₅BrClN

InChI: InChI=1/C6H5BrClN/c1-4-6(8)2-5(7)3-9-4/h2-3H,1H3

SMILES: Cc1c(cc(cn1)Br)Cl

Synonyms:

• 5-Bromo-3-Chloro-2-Methylpyridine
• Pyridine, 5-Bromo-3-Chloro-2-Methyl-

5-Bromo-3-chloro-2-methylpyridine

CAS: 914358-72-8

Formula: C₆H₅BrClN

Purity: 96%

Color and Shape: Solid

Molecular weight: 206.4676

Ref: IN-DA003MI6

5-Bromo-3-chloro-2-methylpyridine

CAS: 914358-72-8

5-Bromo-3-chloro-2-methylpyridine

Formula: C₆H₅BrClN

Purity: 98%

Color and Shape: faint to light beige/yellow crystalline solid

Molecular weight: 206.47g/mol

Ref: 54-OR315107

5-Bromo-3-chloro-2-methylpyridine

CAS: 914358-72-8

Formula: C₆H₅BrClN

Purity: 96%

Color and Shape: Solid

Molecular weight: 206.47

Ref: 10-F219157