CAS 914365-66-5

3,6-Dihydro-4-(4-methoxyphenyl)-2H-pyran

Description:

3,6-Dihydro-4-(4-methoxyphenyl)-2H-pyran, identified by its CAS number 914365-66-5, is an organic compound characterized by its pyran ring structure, which is a six-membered heterocyclic compound containing one oxygen atom. This substance features a methoxyphenyl group at the 4-position of the pyran ring, contributing to its aromatic properties and potential reactivity. The presence of the methoxy group enhances its solubility in organic solvents and may influence its biological activity. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with anti-inflammatory or analgesic properties. Additionally, the dihydro configuration indicates that it may exhibit unique stereochemical properties, which can affect its interaction with biological targets. As with many organic compounds, safety data should be consulted for handling and usage, as well as potential environmental impacts.

Formula: C₁₂H₁₄O₂

InChI: InChI=1S/C12H14O2/c1-13-12-4-2-10(3-5-12)11-6-8-14-9-7-11/h2-6H,7-9H2,1H3

InChI key: InChIKey=LRJHJNQTNOMVGV-UHFFFAOYSA-N

SMILES: O(C)C1=CC=C(C=C1)C=2CCOCC2

Synonyms:

• 4-(4-Methoxyphenyl)-3,6-dihydro-2H-pyran
• 3,6-Dihydro-4-(4-methoxyphenyl)-2H-pyran
• 2H-Pyran, 3,6-dihydro-4-(4-methoxyphenyl)-