CymitQuimica logo

CAS 914381-27-4

:

N-[2-(3-fluorophenyl)ethyl]dodecanamide

Description:
N-[2-(3-fluorophenyl)ethyl]dodecanamide is an organic compound characterized by its amide functional group, which is formed from the reaction of a carboxylic acid and an amine. This compound features a dodecane chain, indicating a long hydrophobic tail, which contributes to its lipophilicity. The presence of a 3-fluorophenyl group introduces a fluorine atom, which can influence the compound's electronic properties and potentially enhance its biological activity. The ethyl linker connects the aromatic ring to the dodecanamide, providing a degree of flexibility in the molecular structure. This compound may exhibit interesting pharmacological properties due to its unique structure, making it a candidate for research in medicinal chemistry. Its solubility, stability, and reactivity can be influenced by the length of the aliphatic chain and the presence of the fluorine substituent. Overall, N-[2-(3-fluorophenyl)ethyl]dodecanamide represents a complex molecule with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C20H32FNO
InChI:InChI=1/C20H32FNO/c1-2-3-4-5-6-7-8-9-10-14-20(23)22-16-15-18-12-11-13-19(21)17-18/h11-13,17H,2-10,14-16H2,1H3,(H,22,23)
SMILES:CCCCCCCCCCCC(=NCCc1cccc(c1)F)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.