CAS 914381-28-5
:6-Fluoro-3,4-dihydro-1-undecylisoquinoline
Description:
6-Fluoro-3,4-dihydro-1-undecylisoquinoline is a chemical compound characterized by its isoquinoline structure, which is a bicyclic compound containing a benzene ring fused to a pyridine ring. The presence of a fluorine atom at the 6-position and an undecyl side chain contributes to its unique properties. This compound is likely to exhibit lipophilicity due to the long undecyl chain, which can influence its solubility and permeability in biological systems. The dihydro form indicates that it has two hydrogen atoms added to the double bond in the isoquinoline structure, which may affect its reactivity and stability. Additionally, the fluorine substitution can enhance the compound's metabolic stability and alter its biological activity. Such compounds are often of interest in medicinal chemistry for their potential pharmacological properties, including effects on neurotransmitter systems or as potential therapeutic agents. However, specific biological activities and applications would require further investigation through empirical studies.
Formula:C20H30FN
InChI:InChI=1S/C20H30FN/c1-2-3-4-5-6-7-8-9-10-11-20-19-13-12-18(21)16-17(19)14-15-22-20/h12-13,16H,2-11,14-15H2,1H3
InChI key:InChIKey=NMHWQPDBDLNIJE-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCC)C=1C=2C(CCN1)=CC(F)=CC2
Synonyms:- Isoquinoline, 6-fluoro-3,4-dihydro-1-undecyl-
- 6-Fluoro-3,4-dihydro-1-undecylisoquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.