CAS 914397-31-2
:N-cyclopropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
Description:
N-cyclopropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide is a chemical compound characterized by its unique structural features, which include a cyclopropyl group and a dioxaborolane moiety. The presence of the dioxaborolane group suggests potential applications in medicinal chemistry, particularly in drug design and development, due to its ability to form stable complexes with various biological targets. The compound's benzamide structure contributes to its potential as a bioactive molecule, influencing its solubility and interaction with biological systems. Additionally, the tetramethyl substituents on the dioxaborolane enhance its steric properties, which can affect reactivity and binding affinity. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in therapeutic applications. Its CAS number, 914397-31-2, allows for easy identification and retrieval of information related to its synthesis, properties, and potential uses in scientific literature. Overall, this compound exemplifies the intersection of organic chemistry and pharmacology, highlighting the importance of structural design in developing new chemical entities.
Formula:C16H22BNO3
InChI:InChI=1/C16H22BNO3/c1-15(2)16(3,4)21-17(20-15)12-7-5-6-11(10-12)14(19)18-13-8-9-13/h5-7,10,13H,8-9H2,1-4H3,(H,18,19)
SMILES:CC1(C)C(C)(C)OB(c2cccc(c2)C(=NC2CC2)O)O1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
N-Cyclopropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
CAS:Formula:C16H22BNO3Molecular weight:287.1618N-cyclopropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
CAS:N-cyclopropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
Molecular weight:287.16g/mol

