CymitQuimica logo

CAS 914397-60-7

:

[3-(dihydroxyboranyl)phenyl]acetic acid

Description:
[3-(Dihydroxyboranyl)phenyl]acetic acid is an organic compound characterized by the presence of a phenyl group substituted with a dihydroxyboranyl group and an acetic acid moiety. This compound features a boron atom bonded to two hydroxyl groups, which contributes to its unique reactivity and potential applications in organic synthesis and materials science. The presence of the carboxylic acid functional group (-COOH) allows for acidic properties and potential interactions with bases or nucleophiles. Additionally, the dihydroxyboranyl group can participate in coordination chemistry, making this compound of interest in the development of boron-containing pharmaceuticals or agrochemicals. Its molecular structure suggests potential for hydrogen bonding, influencing its solubility and reactivity in various solvents. Overall, [3-(dihydroxyboranyl)phenyl]acetic acid exemplifies the intersection of organic chemistry and boron chemistry, showcasing the versatility of boron-containing compounds in synthetic applications.
Formula:C8H9BO4
InChI:InChI=1/C8H9BO4/c10-8(11)5-6-2-1-3-7(4-6)9(12)13/h1-4,12-13H,5H2,(H,10,11)
InChI key:UQOJWKCPHDCNQS-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)B(O)O)CC(=O)O
Found 4 products.