
CAS 91453-04-2
:2-Propenoic-3-d acid, 3-(phenyl-d5)-
Description:
2-Propenoic-3-d acid, 3-(phenyl-d5)-, also known as deuterated phenyl acrylic acid, is a chemical compound characterized by its unique structure that includes a propenoic acid backbone with a phenyl group substituted at the third carbon. The presence of deuterium (d5) in the phenyl group indicates that five hydrogen atoms have been replaced with deuterium isotopes, which can be useful in various analytical techniques, including NMR spectroscopy. This compound typically exhibits properties associated with unsaturated carboxylic acids, such as reactivity in polymerization and potential applications in organic synthesis. Its deuterated nature allows for enhanced tracking and analysis in chemical reactions and biological studies. The compound is likely to be a colorless to pale yellow liquid or solid, depending on its state at room temperature. As with many organic compounds, it should be handled with care, following appropriate safety protocols to mitigate any risks associated with its chemical properties.
Formula:C9H2D6O2
InChI:InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/i1D,2D,3D,4D,5D,6D
InChI key:InChIKey=WBYWAXJHAXSJNI-MZWXYZOWSA-N
SMILES:C(=CC(O)=O)(C1=C(C(=C(C(=C1[2H])[2H])[2H])[2H])[2H])[2H]
Synonyms:- 2-Propenoic-3-d acid, 3-(phenyl-d5)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.