CAS 91454-65-8

[(4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetyl chloride

Description:

The chemical substance known as [(4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetyl chloride, with the CAS number 91454-65-8, is an organic compound characterized by its chromenone structure, which features a coumarin moiety. This compound typically exhibits a yellowish to brownish color and is soluble in organic solvents such as dichloromethane and acetone, but is generally insoluble in water due to its hydrophobic nature. The presence of the acetyl chloride functional group indicates that it is reactive, particularly with nucleophiles, making it useful in various chemical synthesis applications, including acylation reactions. The compound may also display biological activity, as many derivatives of coumarins are known for their pharmacological properties. Safety precautions should be taken when handling this substance, as acetyl chlorides can be corrosive and may release hydrochloric acid upon reaction with moisture. Overall, [(4-methyl-2-oxo-2H-chromen-7-yl)oxy]acetyl chloride is a versatile compound with potential applications in organic synthesis and medicinal chemistry.

Formula: C₁₂H₉ClO₄

InChI: InChI=1/C12H9ClO4/c1-7-4-12(15)17-10-5-8(2-3-9(7)10)16-6-11(13)14/h2-5H,6H2,1H3

SMILES: Cc1cc(=O)oc2cc(ccc12)OCC(=O)Cl

Synonyms:

• Acetyl chloride, ((4-methyl-2-oxo-2H-1-benzopyran-7-yl)oxy)-, (S)-

[(4-Methyl-2-oxo-2H-chromen-8-yl)oxy]acetyl chloride

CAS: 91454-65-8

[(4-Methyl-2-oxo-2H-chromen-8-yl)oxy]acetyl chloride

Purity: 95%

Molecular weight: 252.65g/mol

Ref: 54-OR1002657