CAS 91463-82-0
:(1R)-5-methyl-1-phenyl-3,4,5,6-tetrahydro-1H-2,5-benzoxazocine
Description:
(1R)-5-methyl-1-phenyl-3,4,5,6-tetrahydro-1H-2,5-benzoxazocine is a chemical compound characterized by its complex bicyclic structure, which includes a benzene ring fused to a nitrogen-containing heterocycle. This compound features a methyl group and a phenyl group, contributing to its unique properties and potential biological activity. The presence of the tetrahydro structure indicates that it has multiple saturated carbon atoms, which can influence its reactivity and stability. The stereochemistry denoted by (1R) suggests a specific three-dimensional arrangement of atoms, which can significantly affect the compound's interactions with biological systems, including receptor binding and pharmacological effects. As a member of the benzoxazocine family, it may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its CAS number, 91463-82-0, allows for easy identification and retrieval of information related to its synthesis, applications, and safety data in chemical databases.
Formula:C17H19NO
InChI:InChI=1/C17H19NO/c1-18-11-12-19-17(14-7-3-2-4-8-14)16-10-6-5-9-15(16)13-18/h2-10,17H,11-13H2,1H3/t17-/m1/s1
SMILES:CN1CCO[C@H](c2ccccc2)c2ccccc2C1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(-)-Nefopam
CAS:(-)-Nefopam is a medicinal compound that acts as an inhibitor of kinases, which are enzymes involved in many cellular processes. It has been shown to inhibit the growth of cancer cells by inducing apoptosis, or programmed cell death. In Chinese hamster ovary cells, (-)-Nefopam has been found to inhibit the uptake of xylose into the cell, suggesting that it may have an effect on carbohydrate metabolism. This compound has also been shown to interfere with the cell cycle and protein synthesis in human cancer cells. Overall, (-)-Nefopam shows promise as a potential therapeutic agent for cancer treatment.
Formula:C17H19NOPurity:Min. 95%Molecular weight:253.34 g/mol


