CymitQuimica logo

CAS 914636-27-4

:

2-[1-(4,5-Dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)propylidene]hydrazinecarbothioamide

Description:
2-[1-(4,5-Dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)propylidene]hydrazinecarbothioamide, with the CAS number 914636-27-4, is a chemical compound characterized by its complex structure, which includes a hydrazinecarbothioamide moiety and a substituted pyrazole ring. This compound typically exhibits properties associated with both hydrazine derivatives and thioamide functionalities, which may contribute to its potential biological activity. The presence of the pyrazole ring suggests possible applications in medicinal chemistry, as pyrazoles are known for their diverse pharmacological properties. Additionally, the compound may display specific reactivity due to the thioamide group, which can participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. Its solubility, stability, and reactivity can vary based on the solvent and environmental conditions. Overall, this compound's unique structural features may make it of interest in research fields such as drug development and synthetic chemistry.
Formula:C14H17N5OS
InChI:InChI=1S/C14H17N5OS/c1-3-11(16-17-14(15)21)12-9(2)18-19(13(12)20)10-7-5-4-6-8-10/h4-8,12H,3H2,1-2H3,(H3,15,17,21)
InChI key:InChIKey=OTSSMGDBYOBPRY-UHFFFAOYSA-N
SMILES:O=C1N(N=C(C)C1C(=NNC(N)=S)CC)C2=CC=CC=C2
Synonyms:
  • 2-[1-(4,5-Dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)propylidene]hydrazinecarbothioamide
  • Hydrazinecarbothioamide, 2-[1-(4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)propylidene]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.