CymitQuimica logo

CAS 914636-50-3

:

4-Fluoro-3-(methylsulfonyl)benzaldehyde

Description:
4-Fluoro-3-(methylsulfonyl)benzaldehyde is an organic compound characterized by the presence of a fluorine atom, a methylsulfonyl group, and an aldehyde functional group attached to a benzene ring. Its molecular structure features a fluorine substituent at the para position and a methylsulfonyl group at the meta position relative to the aldehyde group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity due to the aldehyde functional group, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The presence of the methylsulfonyl group enhances its solubility in polar solvents and may influence its biological activity, making it of interest in medicinal chemistry and material science. Additionally, the fluorine atom can impart unique electronic properties, potentially affecting the compound's reactivity and interaction with biological targets. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C8H7FO3S
InChI:InChI=1S/C8H7FO3S/c1-13(11,12)8-4-6(5-10)2-3-7(8)9/h2-5H,1H3
InChI key:InChIKey=FDMWHGMGGVHVLM-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=CC(C=O)=CC=C1F
Synonyms:
  • Benzaldehyde, 4-fluoro-3-(methylsulfonyl)-
  • 4-Fluoro-3-(methylsulfonyl)benzaldehyde
  • 4-Fluoro-3-(methylsulfonyl)
  • 4-Fluoro-3-(methylsulfonyl)benzaldehyde ISO 9001:2015 REACH
Found 4 products.