CAS 914636-63-8

3-(2-Amino-4-bromophenyl)-2-propenoic acid

Description:

3-(2-Amino-4-bromophenyl)-2-propenoic acid, also known by its CAS number 914636-63-8, is an organic compound characterized by the presence of both an amino group and a bromine atom on a phenyl ring, along with a propenoic acid functional group. This compound typically exhibits properties associated with both aromatic and unsaturated carboxylic acids. The amino group can participate in hydrogen bonding, influencing its solubility in polar solvents, while the bromine atom can enhance the compound's reactivity in electrophilic substitution reactions. The propenoic acid moiety contributes to its potential as a building block in organic synthesis, particularly in the formation of polymers or other complex molecules. Additionally, the presence of the bromine atom may impart unique biological activities, making it of interest in medicinal chemistry. Overall, this compound's structure suggests it may have applications in various fields, including pharmaceuticals and materials science, due to its functional groups and reactivity.

Formula: C₉H₈BrNO₂

InChI: InChI=1S/C9H8BrNO2/c10-7-3-1-6(8(11)5-7)2-4-9(12)13/h1-5H,11H2,(H,12,13)

InChI key: InChIKey=ODONURMUGHIPAH-UHFFFAOYSA-N

SMILES: C(=CC(O)=O)C1=C(N)C=C(Br)C=C1

Synonyms:

• 3-(2-Amino-4-bromophenyl)-2-propenoic acid
• 2-Propenoic acid, 3-(2-amino-4-bromophenyl)-
• 3-(2-Amino-4-bromophenyl)acrylic acid
• 2-AMINO-4-BROMOCINNAMIC ACID

2-Amino-4-bromocinnamic acid

CAS: 914636-63-8

2-Amino-4-bromocinnamic acid

Purity: ≥95%

Molecular weight: 242.07g/mol

Ref: 54-OR11324

2-Amino-4-bromocinnamic acid

CAS: 914636-63-8

2-Amino-4-bromocinnamic acid is a fine chemical with a CAS number of 914636-63-8. It is used in the synthesis of complex compounds and useful building blocks, as well as in research. This compound has been shown to be an intermediate for the preparation of derivatives with potential pharmaceutical applications, such as antihistamines, antipsychotics, and antibiotics. 2-Amino-4-bromocinnamic acid is also an important reagent for organic syntheses.

Formula: C₉H₈BrNO₂

Purity: Min. 98 Area-%

Color and Shape: Powder

Molecular weight: 242.07 g/mol

Ref: 3D-FA70077