CymitQuimica logo

CAS 914636-95-6

:

2-(Trifluoromethyl)-1,3-dioxolane-2-methanol

Description:
2-(Trifluoromethyl)-1,3-dioxolane-2-methanol is a chemical compound characterized by its unique structure, which includes a dioxolane ring and a trifluoromethyl group. This compound typically exhibits properties associated with both polar and nonpolar characteristics due to the presence of the trifluoromethyl group, which can influence its reactivity and solubility in various solvents. The dioxolane moiety contributes to its stability and potential applications in organic synthesis. As a methanol derivative, it may also exhibit hydroxyl group reactivity, making it a candidate for further chemical transformations. The trifluoromethyl group is known for imparting unique electronic properties, enhancing the compound's potential as a building block in pharmaceuticals and agrochemicals. Additionally, the presence of fluorine atoms can affect the compound's boiling point, melting point, and overall volatility. Safety data should be consulted for handling and storage, as fluorinated compounds can pose specific health and environmental risks. Overall, this compound's distinctive features make it of interest in various fields of chemical research and application.
Formula:C5H7F3O3
InChI:InChI=1S/C5H7F3O3/c6-5(7,8)4(3-9)10-1-2-11-4/h9H,1-3H2
InChI key:InChIKey=AOBHTXFZZPUOGU-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1(CO)OCCO1
Synonyms:
  • 2-(Trifluoromethyl)-1,3-dioxolan-2-methanol
  • 2-(Trifluoromethyl)-1,3-dioxolane-2-methanol
  • 1,3-Dioxolane-2-methanol, 2-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.