CAS 914637-24-4

4-(2-Furanyl)-2-pyridinecarboxylic acid

Description:

4-(2-Furanyl)-2-pyridinecarboxylic acid, identified by its CAS number 914637-24-4, is an organic compound characterized by the presence of both a pyridine and a furan ring in its structure. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The furan moiety, a five-membered aromatic ring containing oxygen, imparts unique electronic properties, while the pyridine ring, a six-membered aromatic ring with nitrogen, enhances its basicity and potential for coordination with metal ions. The compound is likely to exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, the compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Overall, 4-(2-Furanyl)-2-pyridinecarboxylic acid is a versatile compound with significant implications in various chemical and biological contexts.

Formula: C₁₀H₇NO₃

InChI: InChI=1S/C10H7NO3/c12-10(13)8-6-7(3-4-11-8)9-2-1-5-14-9/h1-6H,(H,12,13)

InChI key: InChIKey=RTTFEZNAJOTLAO-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(=CC=N1)C2=CC=CO2

Synonyms:

• 2-Pyridinecarboxylic acid, 4-(2-furanyl)-
• 4-(2-Furanyl)-2-pyridinecarboxylic acid
• 4-(Furan-2-yl)picolinic acid

4-(Fur-2-yl)pyridine-2-carboxylic acid

CAS: 914637-24-4

4-(Fur-2-yl)pyridine-2-carboxylic acid

Purity: 95%

Color and Shape: Powder

Molecular weight: 189.17g/mol

Ref: 54-OR6253