CAS 914637-76-6

5-Methyl-4-oxazolecarbonyl chloride

Description:

5-Methyl-4-oxazolecarbonyl chloride is a chemical compound characterized by its oxazole ring structure, which features a five-membered aromatic heterocycle containing nitrogen and oxygen. This compound is typically used in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals due to its reactive carbonyl chloride functional group. The presence of the carbonyl chloride moiety makes it a versatile intermediate for acylation reactions, allowing for the introduction of acyl groups into other molecules. Its methyl substituent at the 5-position of the oxazole ring can influence its reactivity and solubility properties. As with many carbonyl chlorides, it is likely to be sensitive to moisture and may react with water to form corresponding acids. Safety precautions should be taken when handling this compound, as it may be corrosive and harmful if inhaled or ingested. Overall, 5-Methyl-4-oxazolecarbonyl chloride is an important building block in synthetic organic chemistry, with applications in various chemical industries.

Formula: C₅H₄ClNO₂

InChI: InChI=1S/C5H4ClNO2/c1-3-4(5(6)8)7-2-9-3/h2H,1H3

InChI key: InChIKey=KEZILNYHDBBHBM-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C1=C(C)OC=N1

Synonyms:

• 5-Methyl-4-oxazolecarbonyl chloride
• 4-Oxazolecarbonyl chloride, 5-methyl-

5-Methyl-1,3-oxazole-4-carbonyl chloride

CAS: 914637-76-6

5-Methyl-1,3-oxazole-4-carbonyl chloride

Purity: 95%

Color and Shape: Dark Red Solid

Molecular weight: 145.54g/mol

Ref: 54-OR6378