CAS 914654-78-7

Pentitol, 1,4-anhydro-2,3,5-trideoxy-3-(1-piperazinyl)-

Description:

Pentitol, 1,4-anhydro-2,3,5-trideoxy-3-(1-piperazinyl)- is a chemical compound characterized by its unique structural features, which include a pentitol backbone and a piperazine moiety. This compound is classified as a sugar derivative due to its trideoxy nature, indicating the absence of hydroxyl groups at specific positions on the sugar ring. The presence of the piperazine group suggests potential pharmacological properties, as piperazine derivatives are often explored for their biological activity. The anhydro form indicates that it has undergone dehydration, which can influence its reactivity and stability. This compound may exhibit solubility in polar solvents, typical of sugar derivatives, and could participate in various chemical reactions, including glycosylation or substitution reactions. Its specific applications and biological activities would depend on further research, particularly in medicinal chemistry, where such compounds are often investigated for therapeutic potential. Overall, the structural characteristics of this compound suggest it may have interesting properties worth exploring in various scientific fields.

Formula: C₉H₁₈N₂O

InChI: InChI=1S/C9H18N2O/c1-8-9(2-7-12-8)11-5-3-10-4-6-11/h8-10H,2-7H2,1H3

InChI key: InChIKey=STXPTGPSGLYDTJ-UHFFFAOYSA-N

SMILES: CC1C(CCO1)N2CCNCC2

Synonyms:

• Pentitol, 1,4-anhydro-2,3,5-trideoxy-3-(1-piperazinyl)-
• 1-(2-Methyltetrahydro-3-furanyl)piperazine