CAS 91467-48-0
:2-hydrazino-5-nitro-1H-benzimidazole
Description:
2-Hydrazino-5-nitro-1H-benzimidazole is an organic compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. The presence of a hydrazino group (-NH-NH2) and a nitro group (-NO2) at specific positions on the benzimidazole framework contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydrazino group. It is often studied for its potential biological activities, including antimicrobial and antitumor properties, owing to the reactivity of the nitro group and the ability of the hydrazino group to participate in various chemical reactions. Additionally, the compound may undergo various transformations under different conditions, making it of interest in synthetic chemistry and medicinal chemistry research. Safety precautions should be observed when handling this compound, as nitro-containing compounds can be hazardous.
Formula:C7H7N5O2
InChI:InChI=1/C7H7N5O2/c8-11-7-9-5-2-1-4(12(13)14)3-6(5)10-7/h1-3H,8H2,(H2,9,10,11)
SMILES:c1cc2c(cc1N(=O)=O)[nH]c(n2)NN
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Hydrazino-5-nitro-1H-1,3-benzimidazole
CAS:<p>2-Hydrazino-5-nitro-1H-1,3-benzimidazole</p>Molecular weight:193.16g/mol
