CymitQuimica logo

CAS 914675-52-8

:

Biphenyl-2-boronic acid pinacol ester

Description:
Biphenyl-2-boronic acid pinacol ester is an organoboron compound characterized by the presence of a biphenyl moiety and a boronic acid functional group that is esterified with pinacol. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible complexes with diols and other Lewis bases, making it useful in various chemical reactions, particularly in Suzuki-Miyaura cross-coupling reactions. The pinacol ester enhances its stability and solubility in organic solvents. It is often utilized in organic synthesis and medicinal chemistry for the development of pharmaceuticals and agrochemicals. The compound is generally stable under standard laboratory conditions but should be handled with care due to the potential reactivity of the boronic acid group. Its applications extend to materials science, where it may be involved in the synthesis of polymers or other advanced materials. As with many organoboron compounds, it is important to consider safety and environmental regulations when handling and disposing of this substance.
Formula:C18H21BO2
InChI:InChI=1S/C18H21BO2/c1-17(2)18(3,4)21-19(20-17)16-13-9-8-12-15(16)14-10-6-5-7-11-14/h5-13H,1-4H3
InChI key:WCXWQEUBHZKNMQ-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2C3=CC=CC=C3
Synonyms:
  • Biphenyl-2-boronic acid pinaco
  • Biphenyl-2-boronic acid pinacol ester, 97%
Found 6 products.