CAS 91477-84-8

4-Phenyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine

Description:

4-Phenyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a thieno and a pyridine moiety. This compound features a phenyl group attached to the tetrahydrothieno ring, contributing to its aromatic properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of nitrogen in the pyridine ring and sulfur in the thieno ring can influence its reactivity and potential biological activity, making it of interest in medicinal chemistry. The compound may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, due to the electron-rich nature of the aromatic systems. Its structural characteristics suggest potential applications in pharmaceuticals, particularly in the development of compounds targeting neurological disorders or other therapeutic areas. As with many heterocycles, the specific properties, such as melting point, boiling point, and spectral data, would depend on the purity and specific conditions under which the compound is studied.

Formula: C₁₃H₁₄NS

InChI: InChI=1/C13H13NS/c1-2-4-10(5-3-1)13-11-7-9-15-12(11)6-8-14-13/h1-5,7,9,13-14H,6,8H2/p+1/t13-/m0/s1

Synonyms:

• 4-Phenyl-4,5,6,7-tetrahydro-thieno[3,2-c]pyridine
• Thieno[3,2-C]Pyridine, 4,5,6,7-Tetrahydro-4-Phenyl-
• (4R)-4-phenyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium
• (4S)-4-phenyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium