CymitQuimica logo

CAS 914780-97-5

:

8-Methyl-1,4-dioxaspiro[4.5]decane-8-carbonitrile

Description:
8-Methyl-1,4-dioxaspiro[4.5]decane-8-carbonitrile is a chemical compound characterized by its unique spirocyclic structure, which includes a dioxane moiety and a nitrile functional group. The presence of the methyl group contributes to its hydrophobic characteristics, while the dioxaspiro framework imparts rigidity and potential for specific interactions in biological systems. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for research in medicinal chemistry. The nitrile group can participate in various chemical reactions, including nucleophilic additions and cycloadditions, enhancing its versatility in synthetic applications. Additionally, the compound's stability and solubility can be influenced by the presence of the dioxane ring and the spiro configuration, which may affect its behavior in different solvents. Overall, 8-Methyl-1,4-dioxaspiro[4.5]decane-8-carbonitrile represents a complex structure that could be of interest in various fields, including drug development and materials science.
Formula:C10H15NO2
InChI:InChI=1S/C10H15NO2/c1-9(8-11)2-4-10(5-3-9)12-6-7-13-10/h2-7H2,1H3
InChI key:InChIKey=JNFOVWRVUGBVAH-UHFFFAOYSA-N
SMILES:C(#N)C1(C)CCC2(CC1)OCCO2
Synonyms:
  • 1,4-Dioxaspiro[4.5]decane-8-carbonitrile, 8-methyl-
  • 8-Methyl-1,4-dioxaspiro[4.5]decane-8-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.