
CAS 91482-37-0
:5,9-Undecadien-2-ol, 6,10-dimethyl-, 2-acetate
Description:
5,9-Undecadien-2-ol, 6,10-dimethyl-, 2-acetate, with the CAS number 91482-37-0, is an organic compound characterized by its long carbon chain and functional groups. It features a diene structure, indicating the presence of two double bonds within its undecadiene backbone, which contributes to its reactivity and potential applications in organic synthesis. The presence of a hydroxyl group (-OH) indicates that it is an alcohol, while the acetate functional group (-OCOCH3) suggests it can participate in esterification reactions. This compound is likely to be a colorless to pale yellow liquid with a characteristic odor, typical of many organic compounds with similar structures. Its molecular structure allows for various interactions, making it useful in the fragrance and flavor industry, as well as in chemical synthesis. Additionally, due to its unsaturation, it may undergo reactions such as hydrogenation or polymerization. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C15H26O2
InChI:InChI=1S/C15H26O2/c1-12(2)8-6-9-13(3)10-7-11-14(4)17-15(5)16/h8,10,14H,6-7,9,11H2,1-5H3
InChI key:InChIKey=BXGLLMNDXKACMT-UHFFFAOYSA-N
SMILES:C(C(OC(C)=O)C)CC=C(CCC=C(C)C)C
Synonyms:- 5,9-Undecadien-2-ol, 6,10-dimethyl-, acetate
- 5,9-Undecadien-2-ol, 6,10-dimethyl-, 2-acetate
- (±)-β,γ-Dihydropseudoionyl acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Tangerinol
CAS:Tangerinol is a potent kinase inhibitor that has shown promising results in the treatment of tumors and cancer. It works by inhibiting the activity of kinases, which are enzymes that play a crucial role in cell signaling pathways. Tangerinol induces apoptosis or programmed cell death in cancer cells, leading to their destruction. It is derived from D-xylose, a natural sugar found in Chinese medicinal plants. Tangerinol has been found to be effective against various types of cancer cells and has been detected in human urine after oral administration. This protein inhibitor shows great potential as a novel therapeutic agent for the treatment of cancer.Formula:C15H26O2Purity:Min. 95%Molecular weight:238.37 g/mol
