CAS 91484-81-0
:8,9,10,11-tetrahydrotetraphen-8-ol
Description:
8,9,10,11-tetrahydrotetraphen-8-ol is a chemical compound characterized by its complex polycyclic structure, which includes multiple phenyl groups and a hydroxyl functional group. This compound is part of a larger class of organic molecules known for their potential applications in various fields, including pharmaceuticals and materials science. The presence of the tetrahydro configuration indicates that the compound has undergone partial hydrogenation, resulting in a saturated structure that can influence its reactivity and stability. The hydroxyl group contributes to its polarity, potentially enhancing solubility in polar solvents and affecting its interaction with biological systems. Additionally, the compound's unique arrangement of phenyl rings may impart interesting optical and electronic properties, making it a subject of interest in research related to organic electronics or photonics. Overall, 8,9,10,11-tetrahydrotetraphen-8-ol exemplifies the intricate relationship between molecular structure and functional properties in organic chemistry.
Formula:C18H16O
InChI:InChI=1/C18H16O/c19-18-7-3-5-13-10-16-14(11-17(13)18)9-8-12-4-1-2-6-15(12)16/h1-2,4,6,8-11,18-19H,3,5,7H2
SMILES:c1ccc2c(c1)ccc1cc3c(CCCC3O)cc21
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.