CAS 91489-09-7

methyl 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate

Description:

Methyl 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate is an organic compound characterized by its unique bicyclic structure that includes a benzothiophene moiety. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, which contributes to its stability and reactivity. The carboxylate functional group, derived from the carboxylic acid, suggests potential for various chemical reactions, including esterification and nucleophilic substitutions. The methyl ester group enhances its solubility in organic solvents, making it useful in synthetic applications. Additionally, the presence of sulfur in the thiophene ring can impart distinct electronic properties, influencing its reactivity and interactions with other chemical species. Methyl 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific biological activities or industrial uses would require further investigation. Overall, its structural features make it a compound of interest in various fields of chemistry.

Formula: C₁₀H₁₂O₂S

InChI: InChI=1/C10H12O2S/c1-12-10(11)9-6-7-4-2-3-5-8(7)13-9/h6H,2-5H2,1H3

SMILES: COC(=O)c1cc2CCCCc2s1

Methyl 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate

CAS: 91489-09-7

Formula: C₁₀H₁₂O₂S

Purity: 95%

Molecular weight: 196.2661

Ref: IN-DA019IS0

Methyl 4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylate

CAS: 91489-09-7

Methyl 4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylate

Purity: ≥95%

Molecular weight: 196.27g/mol

Ref: 54-OR52032