CAS 91494-43-8

1-(2-chloropropanoyl)-1,2,3,4-tetrahydroquinoline

Description:

1-(2-Chloropropanoyl)-1,2,3,4-tetrahydroquinoline is an organic compound characterized by its unique structure, which includes a tetrahydroquinoline moiety and a 2-chloropropanoyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to its fused ring structure. The presence of the chloropropanoyl group introduces a polar functional group, which can influence its solubility and reactivity. Generally, compounds of this nature may display moderate to high lipophilicity, making them potentially useful in medicinal chemistry and drug development. The tetrahydroquinoline framework is often associated with various biological activities, including potential neuroprotective and anti-inflammatory effects. Additionally, the chlorine atom can enhance the compound's reactivity, allowing for further chemical modifications. Safety and handling considerations are essential, as with many organic compounds, due to potential toxicity and environmental impact. Overall, 1-(2-chloropropanoyl)-1,2,3,4-tetrahydroquinoline represents a compound of interest in both synthetic and pharmaceutical chemistry.

Formula: C₁₂H₁₄ClNO

InChI: InChI=1/C12H14ClNO/c1-9(13)12(15)14-8-4-6-10-5-2-3-7-11(10)14/h2-3,5,7,9H,4,6,8H2,1H3

SMILES: CC(C(=O)N1CCCc2ccccc12)Cl

Synonyms:

• 2-Chloro-1-(3,4-dihydro-2H-quinolin-1-yl)-propan-1-one

2-Chloro-1-(3,4-dihydro-2h-quinolin-1-yl)-propan-1-one

CAS: 91494-43-8

Formula: C₁₂H₁₄ClNO

Molecular weight: 223.6987

Ref: IN-DA00IGQ8

2-Chloro-1-(1,2,3,4-tetrahydroquinolyl)propan-1-one

CAS: 91494-43-8

Please enquire for more information about 2-Chloro-1-(1,2,3,4-tetrahydroquinolyl)propan-1-one including the price, delivery time and more detailed product information at the technical inquiry form on this page

Purity: Min. 95%

Ref: 3D-FC169168