CAS 91494-44-9
:3-Chloro-1-(3,4-dihydro-1(2H)-quinolinyl)-1-propanone
Description:
3-Chloro-1-(3,4-dihydro-1(2H)-quinolinyl)-1-propanone is an organic compound characterized by its unique structure, which includes a chloro substituent and a quinoline moiety. The presence of the chloro group indicates that it is likely to exhibit reactivity typical of halogenated compounds, such as participating in nucleophilic substitution reactions. The quinoline structure contributes to its potential biological activity, as many quinoline derivatives are known for their pharmacological properties. This compound may also display moderate to low solubility in water, typical of many organic compounds with larger, aromatic structures. Its molecular weight and specific functional groups suggest that it could be used in various synthetic applications, including medicinal chemistry and the development of new pharmaceuticals. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-Chloro-1-(3,4-dihydro-1(2H)-quinolinyl)-1-propanone represents a class of compounds that may have significant implications in chemical research and drug development.
Formula:C12H14ClNO
InChI:InChI=1S/C12H14ClNO/c13-8-7-12(15)14-9-3-5-10-4-1-2-6-11(10)14/h1-2,4,6H,3,5,7-9H2
InChI key:InChIKey=STUVQWRFSPZHGV-UHFFFAOYSA-N
SMILES:C(CCCl)(=O)N1C=2C(CCC1)=CC=CC2
Synonyms:- 1-propanone, 3-chloro-1-(3,4-dihydro-1(2H)-quinolinyl)-
- 3-Chloro-1-(1,2,3,4-tetrahydroquinolin-1-yl)propan-1-one
- 3-Chloro-1-(3,4-dihydro-1(2H)-quinolinyl)-1-propanone
- 3-Chloro-1-(3,4-dihydro-2H-quinolin-1-yl)propan-1-one
- Quinoline, 1-(3-chloro-1-oxopropyl)-1,2,3,4-tetrahydro-
- Quinoline, 1-(3-chloropropionyl)-1,2,3,4-tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.