CymitQuimica logo

CAS 914941-70-1

:

3,5-Pyridinedicarboxylic acid, 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-, 3-ethyl 5-methyl ester, compd. with 1,2,3,6-tetrahydro-2,6-dioxo-4-pyrimidinecarboxylic acid (1:1)

Description:
The chemical substance with the name "3,5-Pyridinedicarboxylic acid, 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-, 3-ethyl 5-methyl ester, compd. with 1,2,3,6-tetrahydro-2,6-dioxo-4-pyrimidinecarboxylic acid (1:1)" and CAS number 914941-70-1 is a complex organic compound characterized by its multi-functional groups, including pyridine and pyrimidine derivatives. This compound features a pyridine ring substituted with carboxylic acid groups and an ester moiety, which contributes to its potential reactivity and solubility properties. The presence of amino and chlorophenyl groups suggests possible biological activity, making it of interest in pharmaceutical research. The compound's structure indicates it may exhibit various intermolecular interactions, such as hydrogen bonding, due to the presence of both acidic and basic functional groups. Its molecular complexity and specific stereochemistry may influence its physical properties, such as melting point, solubility, and stability under different conditions. Overall, this compound represents a unique entity in the realm of organic chemistry with potential applications in medicinal chemistry.
Formula:C20H25ClN2O5·C5H4N2O4
InChI:InChI=1S/C20H25ClN2O5.C5H4N2O4/c1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21;8-3-1-2(4(9)10)6-5(11)7-3/h5-8,17,23H,4,9-11,22H2,1-3H3;1H,(H,9,10)(H2,6,7,8,11)
InChI key:InChIKey=DBGOBQCYSPDGNR-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(C(C(OC)=O)=C(C)NC1COCCN)C2=C(Cl)C=CC=C2.C(O)(=O)C1=CC(=O)NC(=O)N1
Synonyms:
  • 3,5-Pyridinedicarboxylic acid, 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-, 3-ethyl 5-methyl ester, compd. with 1,2,3,6-tetrahydro-2,6-dioxo-4-pyrimidinecarboxylic acid (1:1)
  • Amlodipine orotate
  • 3,5-Pyridinedicarboxylic acid, 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-, 3-ethyl 5-methyl ester, mono(1,2,3,6-tetrahydro-2,6-dioxo-4-pyrimidinecarboxylate)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.