CymitQuimica logo

CAS 914947-26-5

:

6-Bromo-2-pyridinemethanamine hydrochloride

Description:
6-Bromo-2-pyridinemethanamine hydrochloride is a chemical compound characterized by its structure, which includes a pyridine ring substituted with a bromine atom and an amine group. This compound is typically a white to off-white crystalline solid, soluble in water and polar organic solvents, which makes it useful in various chemical applications. The presence of the bromine atom enhances its reactivity, allowing it to participate in nucleophilic substitution reactions, while the amine group can engage in hydrogen bonding, influencing its solubility and interaction with biological systems. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. This compound is of interest in medicinal chemistry and drug development, particularly for its potential biological activities, including antimicrobial and anticancer properties. Safety data should be reviewed before handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C6H8BrClN2
InChI:InChI=1/C6H7BrN2.ClH/c7-6-3-1-2-5(4-8)9-6;/h1-3H,4,8H2;1H
InChI key:BUAPFSNXCMLJJP-UHFFFAOYSA-N
SMILES:c1cc(CN)nc(c1)Br.Cl
Found 3 products.