CAS 91496-58-1

3-(2-Propoxyphenyl)-2-propenoic acid

Description:

3-(2-Propoxyphenyl)-2-propenoic acid, also known by its CAS number 91496-58-1, is an organic compound characterized by its propenoic acid structure, which features a propoxy-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and unsaturated carboxylic acids. It is likely to be a solid at room temperature, with moderate solubility in organic solvents due to the presence of the hydrophobic propoxy group. The propenoic acid moiety suggests that it may participate in various chemical reactions, such as polymerization or esterification, making it potentially useful in the synthesis of polymers or as an intermediate in organic synthesis. Additionally, the presence of the phenyl group may impart specific reactivity and stability characteristics, influencing its behavior in biological systems or industrial applications. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₂H₁₄O₃

InChI: InChI=1S/C12H14O3/c1-2-9-15-11-6-4-3-5-10(11)7-8-12(13)14/h3-8H,2,9H2,1H3,(H,13,14)

InChI key: InChIKey=AVGAJRVCSFECRC-UHFFFAOYSA-N

SMILES: C(=CC(O)=O)C1=C(OCCC)C=CC=C1

Synonyms:

• Cinnamic acid, o-propoxy-
• 2-Propenoic acid, 3-(2-propoxyphenyl)-
• 3-(2-Propoxyphenyl)-2-propenoic acid